C13H18N2O3 — CID 54890579
2-(1,4-diazepan-1-yl)-2-(3-hydroxyphenyl)acetic acid (PubChem CID 54890579) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-2-(3-hydroxyphenyl)acetic acid.
| Compound Name | 2-(1,4-diazepan-1-yl)-2-(3-hydroxyphenyl)acetic acid |
|---|---|
| PubChem CID | 54890579 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-2-(3-hydroxyphenyl)acetic acid |
| SMILES | O=C(O)C(c1cccc(O)c1)N1CCCNCC1 |
| InChI | InChI=1S/C13H18N2O3/c16-11-4-1-3-10(9-11)12(13(17)18)15-7-2-5-14-6-8-15/h1,3-4,9,12,14,16H,2,5-8H2,(H,17,18) |
| InChIKey | WRXPYDTUWCELKR-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |