C13H15F3N2O3 — CID 107104754
2-piperazin-1-yl-2-[3-(trifluoromethoxy)phenyl]acetic acid (PubChem CID 107104754) has the molecular formula C13H15F3N2O3 and a molecular weight of 304.27 g/mol. Its IUPAC name is 2-piperazin-1-yl-2-[3-(trifluoromethoxy)phenyl]acetic acid.
| Compound Name | 2-piperazin-1-yl-2-[3-(trifluoromethoxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 107104754 |
| Molecular Formula | C13H15F3N2O3 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 2-piperazin-1-yl-2-[3-(trifluoromethoxy)phenyl]acetic acid |
| SMILES | O=C(O)C(c1cccc(OC(F)(F)F)c1)N1CCNCC1 |
| InChI | InChI=1S/C13H15F3N2O3/c14-13(15,16)21-10-3-1-2-9(8-10)11(12(19)20)18-6-4-17-5-7-18/h1-3,8,11,17H,4-7H2,(H,19,20) |
| InChIKey | JZMHRLFQJIKUCI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |