C14H17F3N2O2 — CID 60994386
2-(1,4-diazepan-1-yl)-2-[3-(trifluoromethyl)phenyl]acetic acid (PubChem CID 60994386) has the molecular formula C14H17F3N2O2 and a molecular weight of 302.30 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-2-[3-(trifluoromethyl)phenyl]acetic acid.
| Compound Name | 2-(1,4-diazepan-1-yl)-2-[3-(trifluoromethyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 60994386 |
| Molecular Formula | C14H17F3N2O2 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-2-[3-(trifluoromethyl)phenyl]acetic acid |
| SMILES | O=C(O)C(c1cccc(C(F)(F)F)c1)N1CCCNCC1 |
| InChI | InChI=1S/C14H17F3N2O2/c15-14(16,17)11-4-1-3-10(9-11)12(13(20)21)19-7-2-5-18-6-8-19/h1,3-4,9,12,18H,2,5-8H2,(H,20,21) |
| InChIKey | HHYIVVGOCOUEDM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |