C19H28N2O3 — CID 97201917
(2S)-2-(4-cyclohexyl-1,4-diazepan-1-yl)-2-(3-hydroxyphenyl)acetic acid (PubChem CID 97201917) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is (2S)-2-(4-cyclohexyl-1,4-diazepan-1-yl)-2-(3-hydroxyphenyl)acetic acid.
| Compound Name | (2S)-2-(4-cyclohexyl-1,4-diazepan-1-yl)-2-(3-hydroxyphenyl)acetic acid |
|---|---|
| PubChem CID | 97201917 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | (2S)-2-(4-cyclohexyl-1,4-diazepan-1-yl)-2-(3-hydroxyphenyl)acetic acid |
| SMILES | O=C(O)[C@H](c1cccc(O)c1)N1CCCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C19H28N2O3/c22-17-9-4-6-15(14-17)18(19(23)24)21-11-5-10-20(12-13-21)16-7-2-1-3-8-16/h4,6,9,14,16,18,22H,1-3,5,7-8,10-13H2,(H,23,24)/t18-/m0/s1 |
| InChIKey | GVXIMSKXNGCIGE-SFHVURJKSA-N |
| XLogP | 2.86 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |