C20H31N3O2 — CID 72923444
2-(3-ethylphenyl)-2-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]acetic acid (PubChem CID 72923444) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is 2-(3-ethylphenyl)-2-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]acetic acid.
| Compound Name | 2-(3-ethylphenyl)-2-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 72923444 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | 2-(3-ethylphenyl)-2-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]acetic acid |
| SMILES | CCc1cccc(C(C(=O)O)N2CCN(C3CCN(C)CC3)CC2)c1 |
| InChI | InChI=1S/C20H31N3O2/c1-3-16-5-4-6-17(15-16)19(20(24)25)23-13-11-22(12-14-23)18-7-9-21(2)10-8-18/h4-6,15,18-19H,3,7-14H2,1-2H3,(H,24,25) |
| InChIKey | OOVHLEHIUYXZGB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |