C17H24N2O3 — CID 97207481
(2S)-2-(4-acetyl-1,4-diazepan-1-yl)-2-(3-ethylphenyl)acetic acid (PubChem CID 97207481) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is (2S)-2-(4-acetyl-1,4-diazepan-1-yl)-2-(3-ethylphenyl)acetic acid.
| Compound Name | (2S)-2-(4-acetyl-1,4-diazepan-1-yl)-2-(3-ethylphenyl)acetic acid |
|---|---|
| PubChem CID | 97207481 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | (2S)-2-(4-acetyl-1,4-diazepan-1-yl)-2-(3-ethylphenyl)acetic acid |
| SMILES | CCc1cccc([C@@H](C(=O)O)N2CCCN(C(C)=O)CC2)c1 |
| InChI | InChI=1S/C17H24N2O3/c1-3-14-6-4-7-15(12-14)16(17(21)22)19-9-5-8-18(10-11-19)13(2)20/h4,6-7,12,16H,3,5,8-11H2,1-2H3,(H,21,22)/t16-/m0/s1 |
| InChIKey | QXUBINZVADGERA-INIZCTEOSA-N |
| XLogP | 1.93 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |