C20H29N3O4 — CID 97199710
(2S)-2-(4-acetyl-1,4-diazepan-1-yl)-2-[3-(butylcarbamoyl)phenyl]acetic acid (PubChem CID 97199710) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is (2S)-2-(4-acetyl-1,4-diazepan-1-yl)-2-[3-(butylcarbamoyl)phenyl]acetic acid.
| Compound Name | (2S)-2-(4-acetyl-1,4-diazepan-1-yl)-2-[3-(butylcarbamoyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 97199710 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | (2S)-2-(4-acetyl-1,4-diazepan-1-yl)-2-[3-(butylcarbamoyl)phenyl]acetic acid |
| SMILES | CCCCNC(=O)c1cccc([C@@H](C(=O)O)N2CCCN(C(C)=O)CC2)c1 |
| InChI | InChI=1S/C20H29N3O4/c1-3-4-9-21-19(25)17-8-5-7-16(14-17)18(20(26)27)23-11-6-10-22(12-13-23)15(2)24/h5,7-8,14,18H,3-4,6,9-13H2,1-2H3,(H,21,25)(H,26,27)/t18-/m0/s1 |
| InChIKey | NQCRHUWTEIEOSY-SFHVURJKSA-N |
| XLogP | 1.90 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|