C22H26N2O4 — CID 97198243
(2S)-2-(4-acetyl-1,4-diazepan-1-yl)-2-(4-phenylmethoxyphenyl)acetic acid (PubChem CID 97198243) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is (2S)-2-(4-acetyl-1,4-diazepan-1-yl)-2-(4-phenylmethoxyphenyl)acetic acid.
| Compound Name | (2S)-2-(4-acetyl-1,4-diazepan-1-yl)-2-(4-phenylmethoxyphenyl)acetic acid |
|---|---|
| PubChem CID | 97198243 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | (2S)-2-(4-acetyl-1,4-diazepan-1-yl)-2-(4-phenylmethoxyphenyl)acetic acid |
| SMILES | CC(=O)N1CCCN([C@H](C(=O)O)c2ccc(OCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C22H26N2O4/c1-17(25)23-12-5-13-24(15-14-23)21(22(26)27)19-8-10-20(11-9-19)28-16-18-6-3-2-4-7-18/h2-4,6-11,21H,5,12-16H2,1H3,(H,26,27)/t21-/m0/s1 |
| InChIKey | ZBPXBUFAWQJWAJ-NRFANRHFSA-N |
| XLogP | 2.95 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |