C17H25FN2O — CID 75520090
1-[4-[4-(3-fluorophenyl)butan-2-yl]-1,4-diazepan-1-yl]ethanone (PubChem CID 75520090) has the molecular formula C17H25FN2O and a molecular weight of 292.40 g/mol. Its IUPAC name is 1-[4-[4-(3-fluorophenyl)butan-2-yl]-1,4-diazepan-1-yl]ethanone.
| Compound Name | 1-[4-[4-(3-fluorophenyl)butan-2-yl]-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 75520090 |
| Molecular Formula | C17H25FN2O |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 1-[4-[4-(3-fluorophenyl)butan-2-yl]-1,4-diazepan-1-yl]ethanone |
| SMILES | CC(=O)N1CCCN(C(C)CCc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C17H25FN2O/c1-14(7-8-16-5-3-6-17(18)13-16)19-9-4-10-20(12-11-19)15(2)21/h3,5-6,13-14H,4,7-12H2,1-2H3 |
| InChIKey | GWLCWQLFGXOJCA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |