C21H29FN2O2 — CID 26401825
1-[4-[(3S)-3-[2-(3-fluorophenyl)ethyl]piperidine-1-carbonyl]piperidin-1-yl]ethanone (PubChem CID 26401825) has the molecular formula C21H29FN2O2 and a molecular weight of 360.47 g/mol. Its IUPAC name is 1-[4-[(3S)-3-[2-(3-fluorophenyl)ethyl]piperidine-1-carbonyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[(3S)-3-[2-(3-fluorophenyl)ethyl]piperidine-1-carbonyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 26401825 |
| Molecular Formula | C21H29FN2O2 |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 1-[4-[(3S)-3-[2-(3-fluorophenyl)ethyl]piperidine-1-carbonyl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(C(=O)N2CCC[C@H](CCc3cccc(F)c3)C2)CC1 |
| InChI | InChI=1S/C21H29FN2O2/c1-16(25)23-12-9-19(10-13-23)21(26)24-11-3-5-18(15-24)8-7-17-4-2-6-20(22)14-17/h2,4,6,14,18-19H,3,5,7-13,15H2,1H3/t18-/m1/s1 |
| InChIKey | ZIGYRBOTWUMABX-GOSISDBHSA-N |
| XLogP | 3.26 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |