C20H27FN2O2 — CID 26327850
1-[2-[(3S)-3-[2-(3-fluorophenyl)ethyl]piperidin-1-yl]-2-oxoethyl]piperidin-2-one (PubChem CID 26327850) has the molecular formula C20H27FN2O2 and a molecular weight of 346.45 g/mol. Its IUPAC name is 1-[2-[(3S)-3-[2-(3-fluorophenyl)ethyl]piperidin-1-yl]-2-oxoethyl]piperidin-2-one.
| Compound Name | 1-[2-[(3S)-3-[2-(3-fluorophenyl)ethyl]piperidin-1-yl]-2-oxoethyl]piperidin-2-one |
|---|---|
| PubChem CID | 26327850 |
| Molecular Formula | C20H27FN2O2 |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 1-[2-[(3S)-3-[2-(3-fluorophenyl)ethyl]piperidin-1-yl]-2-oxoethyl]piperidin-2-one |
| SMILES | O=C1CCCCN1CC(=O)N1CCC[C@H](CCc2cccc(F)c2)C1 |
| InChI | InChI=1S/C20H27FN2O2/c21-18-7-3-5-16(13-18)9-10-17-6-4-12-22(14-17)20(25)15-23-11-2-1-8-19(23)24/h3,5,7,13,17H,1-2,4,6,8-12,14-15H2/t17-/m1/s1 |
| InChIKey | OKCMNDSVZFLYIY-QGZVFWFLSA-N |
| XLogP | 3.01 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |