C21H29FN2O2 — CID 26328870
1-[3-[(3R)-3-[2-(3-fluorophenyl)ethyl]piperidin-1-yl]-3-oxopropyl]piperidin-2-one (PubChem CID 26328870) has the molecular formula C21H29FN2O2 and a molecular weight of 360.47 g/mol. Its IUPAC name is 1-[3-[(3R)-3-[2-(3-fluorophenyl)ethyl]piperidin-1-yl]-3-oxopropyl]piperidin-2-one.
| Compound Name | 1-[3-[(3R)-3-[2-(3-fluorophenyl)ethyl]piperidin-1-yl]-3-oxopropyl]piperidin-2-one |
|---|---|
| PubChem CID | 26328870 |
| Molecular Formula | C21H29FN2O2 |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 1-[3-[(3R)-3-[2-(3-fluorophenyl)ethyl]piperidin-1-yl]-3-oxopropyl]piperidin-2-one |
| SMILES | O=C1CCCCN1CCC(=O)N1CCC[C@@H](CCc2cccc(F)c2)C1 |
| InChI | InChI=1S/C21H29FN2O2/c22-19-7-3-5-17(15-19)9-10-18-6-4-13-24(16-18)21(26)11-14-23-12-2-1-8-20(23)25/h3,5,7,15,18H,1-2,4,6,8-14,16H2/t18-/m0/s1 |
| InChIKey | DQGOUQDXEKQZHH-SFHVURJKSA-N |
| XLogP | 3.40 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |