C17H23FN2O2 — CID 25485498
N-[2-[(3R)-3-[2-(3-fluorophenyl)ethyl]piperidin-1-yl]-2-oxoethyl]acetamide (PubChem CID 25485498) has the molecular formula C17H23FN2O2 and a molecular weight of 306.38 g/mol. Its IUPAC name is N-[2-[(3R)-3-[2-(3-fluorophenyl)ethyl]piperidin-1-yl]-2-oxoethyl]acetamide.
| Compound Name | N-[2-[(3R)-3-[2-(3-fluorophenyl)ethyl]piperidin-1-yl]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 25485498 |
| Molecular Formula | C17H23FN2O2 |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | N-[2-[(3R)-3-[2-(3-fluorophenyl)ethyl]piperidin-1-yl]-2-oxoethyl]acetamide |
| SMILES | CC(=O)NCC(=O)N1CCC[C@@H](CCc2cccc(F)c2)C1 |
| InChI | InChI=1S/C17H23FN2O2/c1-13(21)19-11-17(22)20-9-3-5-15(12-20)8-7-14-4-2-6-16(18)10-14/h2,4,6,10,15H,3,5,7-9,11-12H2,1H3,(H,19,21)/t15-/m0/s1 |
| InChIKey | MONSEWBVXGQQQB-HNNXBMFYSA-N |
| XLogP | 2.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |