C21H31FN2O — CID 42150617
(1-ethylpiperidin-4-yl)-[(3S)-3-[2-(3-fluorophenyl)ethyl]piperidin-1-yl]methanone (PubChem CID 42150617) has the molecular formula C21H31FN2O and a molecular weight of 346.49 g/mol. Its IUPAC name is (1-ethylpiperidin-4-yl)-[(3S)-3-[2-(3-fluorophenyl)ethyl]piperidin-1-yl]methanone.
| Compound Name | (1-ethylpiperidin-4-yl)-[(3S)-3-[2-(3-fluorophenyl)ethyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 42150617 |
| Molecular Formula | C21H31FN2O |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | (1-ethylpiperidin-4-yl)-[(3S)-3-[2-(3-fluorophenyl)ethyl]piperidin-1-yl]methanone |
| SMILES | CCN1CCC(C(=O)N2CCC[C@H](CCc3cccc(F)c3)C2)CC1 |
| InChI | InChI=1S/C21H31FN2O/c1-2-23-13-10-19(11-14-23)21(25)24-12-4-6-18(16-24)9-8-17-5-3-7-20(22)15-17/h3,5,7,15,18-19H,2,4,6,8-14,16H2,1H3/t18-/m1/s1 |
| InChIKey | MYNBUZHCXBBVQM-GOSISDBHSA-N |
| XLogP | 3.73 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |