C22H34N2O2 — CID 25298064
(1-ethylpiperidin-4-yl)-[(3R)-3-[2-(3-methoxyphenyl)ethyl]piperidin-1-yl]methanone (PubChem CID 25298064) has the molecular formula C22H34N2O2 and a molecular weight of 358.53 g/mol. Its IUPAC name is (1-ethylpiperidin-4-yl)-[(3R)-3-[2-(3-methoxyphenyl)ethyl]piperidin-1-yl]methanone.
| Compound Name | (1-ethylpiperidin-4-yl)-[(3R)-3-[2-(3-methoxyphenyl)ethyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 25298064 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | (1-ethylpiperidin-4-yl)-[(3R)-3-[2-(3-methoxyphenyl)ethyl]piperidin-1-yl]methanone |
| SMILES | CCN1CCC(C(=O)N2CCC[C@@H](CCc3cccc(OC)c3)C2)CC1 |
| InChI | InChI=1S/C22H34N2O2/c1-3-23-14-11-20(12-15-23)22(25)24-13-5-7-19(17-24)10-9-18-6-4-8-21(16-18)26-2/h4,6,8,16,19-20H,3,5,7,9-15,17H2,1-2H3/t19-/m0/s1 |
| InChIKey | ANFZOUHFVAJIKR-IBGZPJMESA-N |
| XLogP | 3.60 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |