C22H27NO4 — CID 95552525
(3-hydroxy-4-methoxyphenyl)-[(3S)-3-[2-(3-methoxyphenyl)ethyl]piperidin-1-yl]methanone (PubChem CID 95552525) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is (3-hydroxy-4-methoxyphenyl)-[(3S)-3-[2-(3-methoxyphenyl)ethyl]piperidin-1-yl]methanone.
| Compound Name | (3-hydroxy-4-methoxyphenyl)-[(3S)-3-[2-(3-methoxyphenyl)ethyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95552525 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | (3-hydroxy-4-methoxyphenyl)-[(3S)-3-[2-(3-methoxyphenyl)ethyl]piperidin-1-yl]methanone |
| SMILES | COc1cccc(CC[C@H]2CCCN(C(=O)c3ccc(OC)c(O)c3)C2)c1 |
| InChI | InChI=1S/C22H27NO4/c1-26-19-7-3-5-16(13-19)8-9-17-6-4-12-23(15-17)22(25)18-10-11-21(27-2)20(24)14-18/h3,5,7,10-11,13-14,17,24H,4,6,8-9,12,15H2,1-2H3/t17-/m1/s1 |
| InChIKey | SRFUHDCEEGZQTN-QGZVFWFLSA-N |
| XLogP | 3.89 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |