C16H25FN2O2S — CID 86787373
1-[4-(3-fluorophenyl)butan-2-yl]-4-methylsulfonyl-1,4-diazepane (PubChem CID 86787373) has the molecular formula C16H25FN2O2S and a molecular weight of 328.45 g/mol. Its IUPAC name is 1-[4-(3-fluorophenyl)butan-2-yl]-4-methylsulfonyl-1,4-diazepane.
| Compound Name | 1-[4-(3-fluorophenyl)butan-2-yl]-4-methylsulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 86787373 |
| Molecular Formula | C16H25FN2O2S |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 1-[4-(3-fluorophenyl)butan-2-yl]-4-methylsulfonyl-1,4-diazepane |
| SMILES | CC(CCc1cccc(F)c1)N1CCCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C16H25FN2O2S/c1-14(7-8-15-5-3-6-16(17)13-15)18-9-4-10-19(12-11-18)22(2,20)21/h3,5-6,13-14H,4,7-12H2,1-2H3 |
| InChIKey | MPDAJOIKQRWCFC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |