C19H28FN3O3 — CID 97201464
(2S)-2-(2-fluoro-5-methoxyphenyl)-2-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]acetic acid (PubChem CID 97201464) has the molecular formula C19H28FN3O3 and a molecular weight of 365.45 g/mol. Its IUPAC name is (2S)-2-(2-fluoro-5-methoxyphenyl)-2-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]acetic acid.
| Compound Name | (2S)-2-(2-fluoro-5-methoxyphenyl)-2-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 97201464 |
| Molecular Formula | C19H28FN3O3 |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | (2S)-2-(2-fluoro-5-methoxyphenyl)-2-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]acetic acid |
| SMILES | COc1ccc(F)c([C@@H](C(=O)O)N2CCN(C3CCN(C)CC3)CC2)c1 |
| InChI | InChI=1S/C19H28FN3O3/c1-21-7-5-14(6-8-21)22-9-11-23(12-10-22)18(19(24)25)16-13-15(26-2)3-4-17(16)20/h3-4,13-14,18H,5-12H2,1-2H3,(H,24,25)/t18-/m0/s1 |
| InChIKey | DVOBQKHBMQUMOR-SFHVURJKSA-N |
| XLogP | 1.67 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |