C18H25FN2O3S — CID 97200141
(2S)-2-(5-fluoro-2-methoxyphenyl)-2-(4-thiomorpholin-4-ylpiperidin-1-yl)acetic acid (PubChem CID 97200141) has the molecular formula C18H25FN2O3S and a molecular weight of 368.47 g/mol. Its IUPAC name is (2S)-2-(5-fluoro-2-methoxyphenyl)-2-(4-thiomorpholin-4-ylpiperidin-1-yl)acetic acid.
| Compound Name | (2S)-2-(5-fluoro-2-methoxyphenyl)-2-(4-thiomorpholin-4-ylpiperidin-1-yl)acetic acid |
|---|---|
| PubChem CID | 97200141 |
| Molecular Formula | C18H25FN2O3S |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | (2S)-2-(5-fluoro-2-methoxyphenyl)-2-(4-thiomorpholin-4-ylpiperidin-1-yl)acetic acid |
| SMILES | COc1ccc(F)cc1[C@@H](C(=O)O)N1CCC(N2CCSCC2)CC1 |
| InChI | InChI=1S/C18H25FN2O3S/c1-24-16-3-2-13(19)12-15(16)17(18(22)23)21-6-4-14(5-7-21)20-8-10-25-11-9-20/h2-3,12,14,17H,4-11H2,1H3,(H,22,23)/t17-/m0/s1 |
| InChIKey | FNSSOBDMNUWHNB-KRWDZBQOSA-N |
| XLogP | 2.47 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |