2-pyrrolidin-1-yl-2-(2,4,5-trimethoxyphenyl)acetic acid

C15H21NO5 — CID 43803535

IUPAC2-pyrrolidin-1-yl-2-(2,4,5-trimethoxyphenyl)acetic acid
SMILESCOc1cc(OC)c(C(C(=O)O)N2CCCC2)cc1OC
InChIInChI=1S/C15H21NO5/c1-19-11-9-13(21-3)12(20-2)8-10(11)14(15(17)18)16-6-4-5-7-16/h8-9,14H,4-7H2,1-3H3,(H,17,18)
InChIKeyLMZZRUHCJLTRNI-UHFFFAOYSA-N
MW295.34 g/mol
LogP1.93
Rot. Bonds6

About 2-pyrrolidin-1-yl-2-(2,4,5-trimethoxyphenyl)acetic acid

2-pyrrolidin-1-yl-2-(2,4,5-trimethoxyphenyl)acetic acid (PubChem CID 43803535) has the molecular formula C15H21NO5 and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-pyrrolidin-1-yl-2-(2,4,5-trimethoxyphenyl)acetic acid.

Molecular Properties

Compound Name2-pyrrolidin-1-yl-2-(2,4,5-trimethoxyphenyl)acetic acid
PubChem CID43803535
Molecular FormulaC15H21NO5
Molecular Weight295.34 g/mol
Exact Mass295.14
IUPAC Name2-pyrrolidin-1-yl-2-(2,4,5-trimethoxyphenyl)acetic acid
SMILESCOc1cc(OC)c(C(C(=O)O)N2CCCC2)cc1OC
InChIInChI=1S/C15H21NO5/c1-19-11-9-13(21-3)12(20-2)8-10(11)14(15(17)18)16-6-4-5-7-16/h8-9,14H,4-7H2,1-3H3,(H,17,18)
InChIKeyLMZZRUHCJLTRNI-UHFFFAOYSA-N
XLogP1.93
TPSA68.23 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500295.34
LogP ≤ 51.93
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-pyrrolidin-1-yl-2-(2,4,5-trimethoxyphenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-pyrrolidin-1-yl-2-(2,4,5-trimethoxyphenyl)acetic acid?
The IUPAC name of 2-pyrrolidin-1-yl-2-(2,4,5-trimethoxyphenyl)acetic acid (CID 43803535) is 2-pyrrolidin-1-yl-2-(2,4,5-trimethoxyphenyl)acetic acid.
What is the SMILES notation for 2-pyrrolidin-1-yl-2-(2,4,5-trimethoxyphenyl)acetic acid?
The canonical SMILES for 2-pyrrolidin-1-yl-2-(2,4,5-trimethoxyphenyl)acetic acid is COc1cc(OC)c(C(C(=O)O)N2CCCC2)cc1OC.
What is the InChIKey of 2-pyrrolidin-1-yl-2-(2,4,5-trimethoxyphenyl)acetic acid?
The InChIKey is LMZZRUHCJLTRNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO5/c1-19-11-9-13(21-3)12(20-2)8-10(11)14(15(17)18)16-6-4-5-7-16/h8-9,14H,4-7H2,1-3H3,(H,17,18).
What are the key properties of 2-pyrrolidin-1-yl-2-(2,4,5-trimethoxyphenyl)acetic acid?
2-pyrrolidin-1-yl-2-(2,4,5-trimethoxyphenyl)acetic acid has a molecular weight of 295.34 g/mol, XLogP of 1.93, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrrolidin-1-yl-2-(2,4,5-trimethoxyphenyl)acetic acid is sourced from PubChem (CID 43803535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).