C22H27NO5 — CID 3973428
1-[phenyl-(2,4,5-trimethoxyphenyl)methyl]piperidine-3-carboxylic acid (PubChem CID 3973428) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is 1-[phenyl-(2,4,5-trimethoxyphenyl)methyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[phenyl-(2,4,5-trimethoxyphenyl)methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 3973428 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 1-[phenyl-(2,4,5-trimethoxyphenyl)methyl]piperidine-3-carboxylic acid |
| SMILES | COc1cc(OC)c(C(c2ccccc2)N2CCCC(C(=O)O)C2)cc1OC |
| InChI | InChI=1S/C22H27NO5/c1-26-18-13-20(28-3)19(27-2)12-17(18)21(15-8-5-4-6-9-15)23-11-7-10-16(14-23)22(24)25/h4-6,8-9,12-13,16,21H,7,10-11,14H2,1-3H3,(H,24,25) |
| InChIKey | XWFOQGJVUYXBMH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |