C21H24ClNO3 — CID 3955631
1-[(5-chloro-2-methoxyphenyl)-(3-methylphenyl)methyl]piperidine-3-carboxylic acid (PubChem CID 3955631) has the molecular formula C21H24ClNO3 and a molecular weight of 373.88 g/mol. Its IUPAC name is 1-[(5-chloro-2-methoxyphenyl)-(3-methylphenyl)methyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(5-chloro-2-methoxyphenyl)-(3-methylphenyl)methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 3955631 |
| Molecular Formula | C21H24ClNO3 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 1-[(5-chloro-2-methoxyphenyl)-(3-methylphenyl)methyl]piperidine-3-carboxylic acid |
| SMILES | COc1ccc(Cl)cc1C(c1cccc(C)c1)N1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C21H24ClNO3/c1-14-5-3-6-15(11-14)20(18-12-17(22)8-9-19(18)26-2)23-10-4-7-16(13-23)21(24)25/h3,5-6,8-9,11-12,16,20H,4,7,10,13H2,1-2H3,(H,24,25) |
| InChIKey | YCMUGRZIHRJYCP-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |