C20H21BrClNO3 — CID 3946598
1-[(4-bromophenyl)-(5-chloro-2-methoxyphenyl)methyl]piperidine-3-carboxylic acid (PubChem CID 3946598) has the molecular formula C20H21BrClNO3 and a molecular weight of 438.75 g/mol. Its IUPAC name is 1-[(4-bromophenyl)-(5-chloro-2-methoxyphenyl)methyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(4-bromophenyl)-(5-chloro-2-methoxyphenyl)methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 3946598 |
| Molecular Formula | C20H21BrClNO3 |
| Molecular Weight | 438.75 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | 1-[(4-bromophenyl)-(5-chloro-2-methoxyphenyl)methyl]piperidine-3-carboxylic acid |
| SMILES | COc1ccc(Cl)cc1C(c1ccc(Br)cc1)N1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C20H21BrClNO3/c1-26-18-9-8-16(22)11-17(18)19(13-4-6-15(21)7-5-13)23-10-2-3-14(12-23)20(24)25/h4-9,11,14,19H,2-3,10,12H2,1H3,(H,24,25) |
| InChIKey | BWOMNLKWGLIIIG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.75 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |