C27H28ClNO4 — CID 5023172
1-[(5-chloro-2-methoxyphenyl)-(2-phenylmethoxyphenyl)methyl]piperidine-3-carboxylic acid (PubChem CID 5023172) has the molecular formula C27H28ClNO4 and a molecular weight of 465.98 g/mol. Its IUPAC name is 1-[(5-chloro-2-methoxyphenyl)-(2-phenylmethoxyphenyl)methyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(5-chloro-2-methoxyphenyl)-(2-phenylmethoxyphenyl)methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 5023172 |
| Molecular Formula | C27H28ClNO4 |
| Molecular Weight | 465.98 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 1-[(5-chloro-2-methoxyphenyl)-(2-phenylmethoxyphenyl)methyl]piperidine-3-carboxylic acid |
| SMILES | COc1ccc(Cl)cc1C(c1ccccc1OCc1ccccc1)N1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C27H28ClNO4/c1-32-24-14-13-21(28)16-23(24)26(29-15-7-10-20(17-29)27(30)31)22-11-5-6-12-25(22)33-18-19-8-3-2-4-9-19/h2-6,8-9,11-14,16,20,26H,7,10,15,17-18H2,1H3,(H,30,31) |
| InChIKey | DZYHZGIVUVQDGZ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.98 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |