C22H26ClNO4 — CID 3561006
1-[(5-chloro-2-ethoxyphenyl)-(2-methoxyphenyl)methyl]piperidine-3-carboxylic acid (PubChem CID 3561006) has the molecular formula C22H26ClNO4 and a molecular weight of 403.91 g/mol. Its IUPAC name is 1-[(5-chloro-2-ethoxyphenyl)-(2-methoxyphenyl)methyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(5-chloro-2-ethoxyphenyl)-(2-methoxyphenyl)methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 3561006 |
| Molecular Formula | C22H26ClNO4 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 1-[(5-chloro-2-ethoxyphenyl)-(2-methoxyphenyl)methyl]piperidine-3-carboxylic acid |
| SMILES | CCOc1ccc(Cl)cc1C(c1ccccc1OC)N1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C22H26ClNO4/c1-3-28-20-11-10-16(23)13-18(20)21(17-8-4-5-9-19(17)27-2)24-12-6-7-15(14-24)22(25)26/h4-5,8-11,13,15,21H,3,6-7,12,14H2,1-2H3,(H,25,26) |
| InChIKey | FGNVFWFVTZETLV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |