C22H24F3NO3 — CID 3253155
1-[(2-ethoxyphenyl)-[2-(trifluoromethyl)phenyl]methyl]piperidine-3-carboxylic acid (PubChem CID 3253155) has the molecular formula C22H24F3NO3 and a molecular weight of 407.43 g/mol. Its IUPAC name is 1-[(2-ethoxyphenyl)-[2-(trifluoromethyl)phenyl]methyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(2-ethoxyphenyl)-[2-(trifluoromethyl)phenyl]methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 3253155 |
| Molecular Formula | C22H24F3NO3 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 1-[(2-ethoxyphenyl)-[2-(trifluoromethyl)phenyl]methyl]piperidine-3-carboxylic acid |
| SMILES | CCOc1ccccc1C(c1ccccc1C(F)(F)F)N1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C22H24F3NO3/c1-2-29-19-12-6-4-10-17(19)20(26-13-7-8-15(14-26)21(27)28)16-9-3-5-11-18(16)22(23,24)25/h3-6,9-12,15,20H,2,7-8,13-14H2,1H3,(H,27,28) |
| InChIKey | HRGJEUNWGCQTQU-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |