C23H29NO4 — CID 3691753
1-[(3,4-diethoxyphenyl)-phenylmethyl]piperidine-3-carboxylic acid (PubChem CID 3691753) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is 1-[(3,4-diethoxyphenyl)-phenylmethyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(3,4-diethoxyphenyl)-phenylmethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 3691753 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 1-[(3,4-diethoxyphenyl)-phenylmethyl]piperidine-3-carboxylic acid |
| SMILES | CCOc1ccc(C(c2ccccc2)N2CCCC(C(=O)O)C2)cc1OCC |
| InChI | InChI=1S/C23H29NO4/c1-3-27-20-13-12-18(15-21(20)28-4-2)22(17-9-6-5-7-10-17)24-14-8-11-19(16-24)23(25)26/h5-7,9-10,12-13,15,19,22H,3-4,8,11,14,16H2,1-2H3,(H,25,26) |
| InChIKey | ZKEQFTBVYXNUQP-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |