C32H33NO4 — CID 4992968
1-[(3-ethoxy-4-phenylmethoxyphenyl)-naphthalen-1-ylmethyl]piperidine-3-carboxylic acid (PubChem CID 4992968) has the molecular formula C32H33NO4 and a molecular weight of 495.62 g/mol. Its IUPAC name is 1-[(3-ethoxy-4-phenylmethoxyphenyl)-naphthalen-1-ylmethyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(3-ethoxy-4-phenylmethoxyphenyl)-naphthalen-1-ylmethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 4992968 |
| Molecular Formula | C32H33NO4 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | 1-[(3-ethoxy-4-phenylmethoxyphenyl)-naphthalen-1-ylmethyl]piperidine-3-carboxylic acid |
| SMILES | CCOc1cc(C(c2cccc3ccccc23)N2CCCC(C(=O)O)C2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C32H33NO4/c1-2-36-30-20-25(17-18-29(30)37-22-23-10-4-3-5-11-23)31(33-19-9-14-26(21-33)32(34)35)28-16-8-13-24-12-6-7-15-27(24)28/h3-8,10-13,15-18,20,26,31H,2,9,14,19,21-22H2,1H3,(H,34,35) |
| InChIKey | YRHFRHDQPFMZBM-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |