C33H33NO4 — CID 3384349
1-[(3-methoxy-4-phenylmethoxyphenyl)-(4-phenylphenyl)methyl]piperidine-3-carboxylic acid (PubChem CID 3384349) has the molecular formula C33H33NO4 and a molecular weight of 507.63 g/mol. Its IUPAC name is 1-[(3-methoxy-4-phenylmethoxyphenyl)-(4-phenylphenyl)methyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(3-methoxy-4-phenylmethoxyphenyl)-(4-phenylphenyl)methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 3384349 |
| Molecular Formula | C33H33NO4 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | 1-[(3-methoxy-4-phenylmethoxyphenyl)-(4-phenylphenyl)methyl]piperidine-3-carboxylic acid |
| SMILES | COc1cc(C(c2ccc(-c3ccccc3)cc2)N2CCCC(C(=O)O)C2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C33H33NO4/c1-37-31-21-28(18-19-30(31)38-23-24-9-4-2-5-10-24)32(34-20-8-13-29(22-34)33(35)36)27-16-14-26(15-17-27)25-11-6-3-7-12-25/h2-7,9-12,14-19,21,29,32H,8,13,20,22-23H2,1H3,(H,35,36) |
| InChIKey | VQGICXRYDLHVHK-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |