C26H28N2O4 — CID 3887365
1-[(3-methoxy-4-phenylmethoxyphenyl)-pyridin-2-ylmethyl]piperidine-3-carboxylic acid (PubChem CID 3887365) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is 1-[(3-methoxy-4-phenylmethoxyphenyl)-pyridin-2-ylmethyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(3-methoxy-4-phenylmethoxyphenyl)-pyridin-2-ylmethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 3887365 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 1-[(3-methoxy-4-phenylmethoxyphenyl)-pyridin-2-ylmethyl]piperidine-3-carboxylic acid |
| SMILES | COc1cc(C(c2ccccn2)N2CCCC(C(=O)O)C2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C26H28N2O4/c1-31-24-16-20(12-13-23(24)32-18-19-8-3-2-4-9-19)25(22-11-5-6-14-27-22)28-15-7-10-21(17-28)26(29)30/h2-6,8-9,11-14,16,21,25H,7,10,15,17-18H2,1H3,(H,29,30) |
| InChIKey | NVIYCJIBCGECQD-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |