C30H30N2O4 — CID 4045952
1-[(3-methoxy-4-phenylmethoxyphenyl)-quinolin-3-ylmethyl]piperidine-3-carboxylic acid (PubChem CID 4045952) has the molecular formula C30H30N2O4 and a molecular weight of 482.58 g/mol. Its IUPAC name is 1-[(3-methoxy-4-phenylmethoxyphenyl)-quinolin-3-ylmethyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(3-methoxy-4-phenylmethoxyphenyl)-quinolin-3-ylmethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 4045952 |
| Molecular Formula | C30H30N2O4 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | 1-[(3-methoxy-4-phenylmethoxyphenyl)-quinolin-3-ylmethyl]piperidine-3-carboxylic acid |
| SMILES | COc1cc(C(c2cnc3ccccc3c2)N2CCCC(C(=O)O)C2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C30H30N2O4/c1-35-28-17-23(13-14-27(28)36-20-21-8-3-2-4-9-21)29(32-15-7-11-24(19-32)30(33)34)25-16-22-10-5-6-12-26(22)31-18-25/h2-6,8-10,12-14,16-18,24,29H,7,11,15,19-20H2,1H3,(H,33,34) |
| InChIKey | RRAPVIXHSKPDDS-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |