C22H21BrN2O2 — CID 5030053
1-[(4-bromophenyl)-quinolin-3-ylmethyl]piperidine-3-carboxylic acid (PubChem CID 5030053) has the molecular formula C22H21BrN2O2 and a molecular weight of 425.33 g/mol. Its IUPAC name is 1-[(4-bromophenyl)-quinolin-3-ylmethyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(4-bromophenyl)-quinolin-3-ylmethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 5030053 |
| Molecular Formula | C22H21BrN2O2 |
| Molecular Weight | 425.33 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 1-[(4-bromophenyl)-quinolin-3-ylmethyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(C(c2ccc(Br)cc2)c2cnc3ccccc3c2)C1 |
| InChI | InChI=1S/C22H21BrN2O2/c23-19-9-7-15(8-10-19)21(25-11-3-5-17(14-25)22(26)27)18-12-16-4-1-2-6-20(16)24-13-18/h1-2,4,6-10,12-13,17,21H,3,5,11,14H2,(H,26,27) |
| InChIKey | XAZRGERAYVUMQZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.33 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |