C23H22N2O4 — CID 4201859
1-[1,3-benzodioxol-5-yl(quinolin-3-yl)methyl]piperidine-4-carboxylic acid (PubChem CID 4201859) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is 1-[1,3-benzodioxol-5-yl(quinolin-3-yl)methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[1,3-benzodioxol-5-yl(quinolin-3-yl)methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 4201859 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 1-[1,3-benzodioxol-5-yl(quinolin-3-yl)methyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(c2ccc3c(c2)OCO3)c2cnc3ccccc3c2)CC1 |
| InChI | InChI=1S/C23H22N2O4/c26-23(27)15-7-9-25(10-8-15)22(17-5-6-20-21(12-17)29-14-28-20)18-11-16-3-1-2-4-19(16)24-13-18/h1-6,11-13,15,22H,7-10,14H2,(H,26,27) |
| InChIKey | RLEYMCPFTXFWDK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |