C24H24BrNO3 — CID 4315687
1-[(5-bromo-2-methoxyphenyl)-naphthalen-2-ylmethyl]piperidine-3-carboxylic acid (PubChem CID 4315687) has the molecular formula C24H24BrNO3 and a molecular weight of 454.36 g/mol. Its IUPAC name is 1-[(5-bromo-2-methoxyphenyl)-naphthalen-2-ylmethyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(5-bromo-2-methoxyphenyl)-naphthalen-2-ylmethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 4315687 |
| Molecular Formula | C24H24BrNO3 |
| Molecular Weight | 454.36 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | 1-[(5-bromo-2-methoxyphenyl)-naphthalen-2-ylmethyl]piperidine-3-carboxylic acid |
| SMILES | COc1ccc(Br)cc1C(c1ccc2ccccc2c1)N1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C24H24BrNO3/c1-29-22-11-10-20(25)14-21(22)23(26-12-4-7-19(15-26)24(27)28)18-9-8-16-5-2-3-6-17(16)13-18/h2-3,5-6,8-11,13-14,19,23H,4,7,12,15H2,1H3,(H,27,28) |
| InChIKey | XASLWSXRCHSVQQ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.36 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |