C22H20F2N2O2 — CID 4588989
1-[(2,4-difluorophenyl)-quinolin-3-ylmethyl]piperidine-3-carboxylic acid (PubChem CID 4588989) has the molecular formula C22H20F2N2O2 and a molecular weight of 382.41 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)-quinolin-3-ylmethyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(2,4-difluorophenyl)-quinolin-3-ylmethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 4588989 |
| Molecular Formula | C22H20F2N2O2 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 1-[(2,4-difluorophenyl)-quinolin-3-ylmethyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(C(c2cnc3ccccc3c2)c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C22H20F2N2O2/c23-17-7-8-18(19(24)11-17)21(26-9-3-5-15(13-26)22(27)28)16-10-14-4-1-2-6-20(14)25-12-16/h1-2,4,6-8,10-12,15,21H,3,5,9,13H2,(H,27,28) |
| InChIKey | RXNCXSFCLYBVAD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |