C28H30FNO4 — CID 3874488
1-[(3-ethoxy-4-phenylmethoxyphenyl)-(4-fluorophenyl)methyl]piperidine-3-carboxylic acid (PubChem CID 3874488) has the molecular formula C28H30FNO4 and a molecular weight of 463.55 g/mol. Its IUPAC name is 1-[(3-ethoxy-4-phenylmethoxyphenyl)-(4-fluorophenyl)methyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(3-ethoxy-4-phenylmethoxyphenyl)-(4-fluorophenyl)methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 3874488 |
| Molecular Formula | C28H30FNO4 |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 1-[(3-ethoxy-4-phenylmethoxyphenyl)-(4-fluorophenyl)methyl]piperidine-3-carboxylic acid |
| SMILES | CCOc1cc(C(c2ccc(F)cc2)N2CCCC(C(=O)O)C2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C28H30FNO4/c1-2-33-26-17-22(12-15-25(26)34-19-20-7-4-3-5-8-20)27(21-10-13-24(29)14-11-21)30-16-6-9-23(18-30)28(31)32/h3-5,7-8,10-15,17,23,27H,2,6,9,16,18-19H2,1H3,(H,31,32) |
| InChIKey | PBJYGBMEDUAOOQ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |