C29H33NO4 — CID 4611423
1-[(3-ethoxy-4-phenylmethoxyphenyl)-(4-methylphenyl)methyl]piperidine-4-carboxylic acid (PubChem CID 4611423) has the molecular formula C29H33NO4 and a molecular weight of 459.59 g/mol. Its IUPAC name is 1-[(3-ethoxy-4-phenylmethoxyphenyl)-(4-methylphenyl)methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(3-ethoxy-4-phenylmethoxyphenyl)-(4-methylphenyl)methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 4611423 |
| Molecular Formula | C29H33NO4 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 1-[(3-ethoxy-4-phenylmethoxyphenyl)-(4-methylphenyl)methyl]piperidine-4-carboxylic acid |
| SMILES | CCOc1cc(C(c2ccc(C)cc2)N2CCC(C(=O)O)CC2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C29H33NO4/c1-3-33-27-19-25(13-14-26(27)34-20-22-7-5-4-6-8-22)28(23-11-9-21(2)10-12-23)30-17-15-24(16-18-30)29(31)32/h4-14,19,24,28H,3,15-18,20H2,1-2H3,(H,31,32) |
| InChIKey | MWPHSFYZJZQDKP-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |