C25H27NO4S — CID 5244582
1-[(3-methoxy-4-phenylmethoxyphenyl)-thiophen-3-ylmethyl]piperidine-4-carboxylic acid (PubChem CID 5244582) has the molecular formula C25H27NO4S and a molecular weight of 437.56 g/mol. Its IUPAC name is 1-[(3-methoxy-4-phenylmethoxyphenyl)-thiophen-3-ylmethyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(3-methoxy-4-phenylmethoxyphenyl)-thiophen-3-ylmethyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 5244582 |
| Molecular Formula | C25H27NO4S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 1-[(3-methoxy-4-phenylmethoxyphenyl)-thiophen-3-ylmethyl]piperidine-4-carboxylic acid |
| SMILES | COc1cc(C(c2ccsc2)N2CCC(C(=O)O)CC2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C25H27NO4S/c1-29-23-15-20(7-8-22(23)30-16-18-5-3-2-4-6-18)24(21-11-14-31-17-21)26-12-9-19(10-13-26)25(27)28/h2-8,11,14-15,17,19,24H,9-10,12-13,16H2,1H3,(H,27,28) |
| InChIKey | MKCGUZKFMBRIPV-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |