C24H32N2O4 — CID 5228885
1-[[4-(dimethylamino)phenyl]-(4-ethoxy-3-methoxyphenyl)methyl]piperidine-3-carboxylic acid (PubChem CID 5228885) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)phenyl]-(4-ethoxy-3-methoxyphenyl)methyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[[4-(dimethylamino)phenyl]-(4-ethoxy-3-methoxyphenyl)methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 5228885 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 1-[[4-(dimethylamino)phenyl]-(4-ethoxy-3-methoxyphenyl)methyl]piperidine-3-carboxylic acid |
| SMILES | CCOc1ccc(C(c2ccc(N(C)C)cc2)N2CCCC(C(=O)O)C2)cc1OC |
| InChI | InChI=1S/C24H32N2O4/c1-5-30-21-13-10-18(15-22(21)29-4)23(17-8-11-20(12-9-17)25(2)3)26-14-6-7-19(16-26)24(27)28/h8-13,15,19,23H,5-7,14,16H2,1-4H3,(H,27,28) |
| InChIKey | QMXMIWUTFHSWMV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|