C19H22ClNO4 — CID 4290710
1-[(5-chloro-2-ethoxyphenyl)-(furan-2-yl)methyl]piperidine-3-carboxylic acid (PubChem CID 4290710) has the molecular formula C19H22ClNO4 and a molecular weight of 363.84 g/mol. Its IUPAC name is 1-[(5-chloro-2-ethoxyphenyl)-(furan-2-yl)methyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(5-chloro-2-ethoxyphenyl)-(furan-2-yl)methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 4290710 |
| Molecular Formula | C19H22ClNO4 |
| Molecular Weight | 363.84 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 1-[(5-chloro-2-ethoxyphenyl)-(furan-2-yl)methyl]piperidine-3-carboxylic acid |
| SMILES | CCOc1ccc(Cl)cc1C(c1ccco1)N1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C19H22ClNO4/c1-2-24-16-8-7-14(20)11-15(16)18(17-6-4-10-25-17)21-9-3-5-13(12-21)19(22)23/h4,6-8,10-11,13,18H,2-3,5,9,12H2,1H3,(H,22,23) |
| InChIKey | GQTAJTUFAWCAJY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.84 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |