C17H18FNO3 — CID 5225573
1-[(2-fluorophenyl)-(furan-2-yl)methyl]piperidine-3-carboxylic acid (PubChem CID 5225573) has the molecular formula C17H18FNO3 and a molecular weight of 303.33 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)-(furan-2-yl)methyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(2-fluorophenyl)-(furan-2-yl)methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 5225573 |
| Molecular Formula | C17H18FNO3 |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 1-[(2-fluorophenyl)-(furan-2-yl)methyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(C(c2ccco2)c2ccccc2F)C1 |
| InChI | InChI=1S/C17H18FNO3/c18-14-7-2-1-6-13(14)16(15-8-4-10-22-15)19-9-3-5-12(11-19)17(20)21/h1-2,4,6-8,10,12,16H,3,5,9,11H2,(H,20,21) |
| InChIKey | MCNGOTMCKZOJAQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |