About 2-(azetidin-1-yl)-2-(4-methoxy-3,5-dimethylphenyl)acetic acid
2-(azetidin-1-yl)-2-(4-methoxy-3,5-dimethylphenyl)acetic acid (PubChem CID 46996116) has the molecular formula C14H19NO3
and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-(azetidin-1-yl)-2-(4-methoxy-3,5-dimethylphenyl)acetic acid.
Analyze 2-(azetidin-1-yl)-2-(4-methoxy-3,5-dimethylphenyl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azetidin-1-yl)-2-(4-methoxy-3,5-dimethylphenyl)acetic acid?
The IUPAC name of 2-(azetidin-1-yl)-2-(4-methoxy-3,5-dimethylphenyl)acetic acid (CID 46996116) is 2-(azetidin-1-yl)-2-(4-methoxy-3,5-dimethylphenyl)acetic acid.
What is the SMILES notation for 2-(azetidin-1-yl)-2-(4-methoxy-3,5-dimethylphenyl)acetic acid?
The canonical SMILES for 2-(azetidin-1-yl)-2-(4-methoxy-3,5-dimethylphenyl)acetic acid is COc1c(C)cc(C(C(=O)O)N2CCC2)cc1C.
What is the InChIKey of 2-(azetidin-1-yl)-2-(4-methoxy-3,5-dimethylphenyl)acetic acid?
The InChIKey is VVKDOELHGJKNCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO3/c1-9-7-11(8-10(2)13(9)18-3)12(14(16)17)15-5-4-6-15/h7-8,12H,4-6H2,1-3H3,(H,16,17).
What are the key properties of 2-(azetidin-1-yl)-2-(4-methoxy-3,5-dimethylphenyl)acetic acid?
2-(azetidin-1-yl)-2-(4-methoxy-3,5-dimethylphenyl)acetic acid has a molecular weight of 249.31 g/mol, XLogP of 2.14, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azetidin-1-yl)-2-(4-methoxy-3,5-dimethylphenyl)acetic acid is sourced from PubChem (CID 46996116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).