2-(3,5-difluorophenyl)-2-pyrrolidin-1-ylacetic acid

C12H13F2NO2 — CID 106531817

IUPAC2-(3,5-difluorophenyl)-2-pyrrolidin-1-ylacetic acid
SMILESO=C(O)C(c1cc(F)cc(F)c1)N1CCCC1
InChIInChI=1S/C12H13F2NO2/c13-9-5-8(6-10(14)7-9)11(12(16)17)15-3-1-2-4-15/h5-7,11H,1-4H2,(H,16,17)
InChIKeyFLVJYHVXNRAFJD-UHFFFAOYSA-N
MW241.24 g/mol
LogP2.19
Rot. Bonds3

About 2-(3,5-difluorophenyl)-2-pyrrolidin-1-ylacetic acid

2-(3,5-difluorophenyl)-2-pyrrolidin-1-ylacetic acid (PubChem CID 106531817) has the molecular formula C12H13F2NO2 and a molecular weight of 241.24 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-2-pyrrolidin-1-ylacetic acid.

Molecular Properties

Compound Name2-(3,5-difluorophenyl)-2-pyrrolidin-1-ylacetic acid
PubChem CID106531817
Molecular FormulaC12H13F2NO2
Molecular Weight241.24 g/mol
Exact Mass241.09
IUPAC Name2-(3,5-difluorophenyl)-2-pyrrolidin-1-ylacetic acid
SMILESO=C(O)C(c1cc(F)cc(F)c1)N1CCCC1
InChIInChI=1S/C12H13F2NO2/c13-9-5-8(6-10(14)7-9)11(12(16)17)15-3-1-2-4-15/h5-7,11H,1-4H2,(H,16,17)
InChIKeyFLVJYHVXNRAFJD-UHFFFAOYSA-N
XLogP2.19
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.24
LogP ≤ 52.19
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(3,5-difluorophenyl)-2-pyrrolidin-1-ylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,5-difluorophenyl)-2-pyrrolidin-1-ylacetic acid?
The IUPAC name of 2-(3,5-difluorophenyl)-2-pyrrolidin-1-ylacetic acid (CID 106531817) is 2-(3,5-difluorophenyl)-2-pyrrolidin-1-ylacetic acid.
What is the SMILES notation for 2-(3,5-difluorophenyl)-2-pyrrolidin-1-ylacetic acid?
The canonical SMILES for 2-(3,5-difluorophenyl)-2-pyrrolidin-1-ylacetic acid is O=C(O)C(c1cc(F)cc(F)c1)N1CCCC1.
What is the InChIKey of 2-(3,5-difluorophenyl)-2-pyrrolidin-1-ylacetic acid?
The InChIKey is FLVJYHVXNRAFJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F2NO2/c13-9-5-8(6-10(14)7-9)11(12(16)17)15-3-1-2-4-15/h5-7,11H,1-4H2,(H,16,17).
What are the key properties of 2-(3,5-difluorophenyl)-2-pyrrolidin-1-ylacetic acid?
2-(3,5-difluorophenyl)-2-pyrrolidin-1-ylacetic acid has a molecular weight of 241.24 g/mol, XLogP of 2.19, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-difluorophenyl)-2-pyrrolidin-1-ylacetic acid is sourced from PubChem (CID 106531817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).