C12H13F3N2O2 — CID 55148515
2-piperazin-1-yl-2-(3,4,5-trifluorophenyl)acetic acid (PubChem CID 55148515) has the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. Its IUPAC name is 2-piperazin-1-yl-2-(3,4,5-trifluorophenyl)acetic acid.
| Compound Name | 2-piperazin-1-yl-2-(3,4,5-trifluorophenyl)acetic acid |
|---|---|
| PubChem CID | 55148515 |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 2-piperazin-1-yl-2-(3,4,5-trifluorophenyl)acetic acid |
| SMILES | O=C(O)C(c1cc(F)c(F)c(F)c1)N1CCNCC1 |
| InChI | InChI=1S/C12H13F3N2O2/c13-8-5-7(6-9(14)10(8)15)11(12(18)19)17-3-1-16-2-4-17/h5-6,11,16H,1-4H2,(H,18,19) |
| InChIKey | PNUOMJABNNIQJC-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|