C17H26N2O5 — CID 83979031
2-(4-ethylpiperazin-1-yl)-2-(3,4,5-trimethoxyphenyl)acetic acid (PubChem CID 83979031) has the molecular formula C17H26N2O5 and a molecular weight of 338.40 g/mol. Its IUPAC name is 2-(4-ethylpiperazin-1-yl)-2-(3,4,5-trimethoxyphenyl)acetic acid.
| Compound Name | 2-(4-ethylpiperazin-1-yl)-2-(3,4,5-trimethoxyphenyl)acetic acid |
|---|---|
| PubChem CID | 83979031 |
| Molecular Formula | C17H26N2O5 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 2-(4-ethylpiperazin-1-yl)-2-(3,4,5-trimethoxyphenyl)acetic acid |
| SMILES | CCN1CCN(C(C(=O)O)c2cc(OC)c(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C17H26N2O5/c1-5-18-6-8-19(9-7-18)15(17(20)21)12-10-13(22-2)16(24-4)14(11-12)23-3/h10-11,15H,5-9H2,1-4H3,(H,20,21) |
| InChIKey | UJVSEBMVZHGNSN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |