C14H19N3O4 — CID 84751162
2-(4-ethylpiperazin-1-yl)-2-(4-nitrophenyl)acetic acid (PubChem CID 84751162) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is 2-(4-ethylpiperazin-1-yl)-2-(4-nitrophenyl)acetic acid.
| Compound Name | 2-(4-ethylpiperazin-1-yl)-2-(4-nitrophenyl)acetic acid |
|---|---|
| PubChem CID | 84751162 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2-(4-ethylpiperazin-1-yl)-2-(4-nitrophenyl)acetic acid |
| SMILES | CCN1CCN(C(C(=O)O)c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C14H19N3O4/c1-2-15-7-9-16(10-8-15)13(14(18)19)11-3-5-12(6-4-11)17(20)21/h3-6,13H,2,7-10H2,1H3,(H,18,19) |
| InChIKey | OFOYTZQPTFXLOQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 86.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|