C22H28N4O4 — CID 3581479
N-(2,6-dimethylphenyl)-2-[4-(2-hydroxyethyl)piperazin-1-yl]-2-(4-nitrophenyl)acetamide (PubChem CID 3581479) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[4-(2-hydroxyethyl)piperazin-1-yl]-2-(4-nitrophenyl)acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[4-(2-hydroxyethyl)piperazin-1-yl]-2-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 3581479 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[4-(2-hydroxyethyl)piperazin-1-yl]-2-(4-nitrophenyl)acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)C(c1ccc([N+](=O)[O-])cc1)N1CCN(CCO)CC1 |
| InChI | InChI=1S/C22H28N4O4/c1-16-4-3-5-17(2)20(16)23-22(28)21(18-6-8-19(9-7-18)26(29)30)25-12-10-24(11-13-25)14-15-27/h3-9,21,27H,10-15H2,1-2H3,(H,23,28) |
| InChIKey | CWAZCFZARFPIRI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 98.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|