C20H23ClN2O2 — CID 7279324
(2S)-2-(4-chlorophenyl)-N-(2,6-dimethylphenyl)-2-morpholin-4-ylacetamide (PubChem CID 7279324) has the molecular formula C20H23ClN2O2 and a molecular weight of 358.87 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenyl)-N-(2,6-dimethylphenyl)-2-morpholin-4-ylacetamide.
| Compound Name | (2S)-2-(4-chlorophenyl)-N-(2,6-dimethylphenyl)-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 7279324 |
| Molecular Formula | C20H23ClN2O2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | (2S)-2-(4-chlorophenyl)-N-(2,6-dimethylphenyl)-2-morpholin-4-ylacetamide |
| SMILES | Cc1cccc(C)c1NC(=O)[C@H](c1ccc(Cl)cc1)N1CCOCC1 |
| InChI | InChI=1S/C20H23ClN2O2/c1-14-4-3-5-15(2)18(14)22-20(24)19(23-10-12-25-13-11-23)16-6-8-17(21)9-7-16/h3-9,19H,10-13H2,1-2H3,(H,22,24)/t19-/m0/s1 |
| InChIKey | FCENRBPUNLDAOK-IBGZPJMESA-N |
| XLogP | 3.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |