C27H24N4O6 — CID 6999320
(2S)-N-(2,6-dimethylphenyl)-2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-methylamino]-2-(4-nitrophenyl)acetamide (PubChem CID 6999320) has the molecular formula C27H24N4O6 and a molecular weight of 500.51 g/mol. Its IUPAC name is (2S)-N-(2,6-dimethylphenyl)-2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-methylamino]-2-(4-nitrophenyl)acetamide.
| Compound Name | (2S)-N-(2,6-dimethylphenyl)-2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-methylamino]-2-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 6999320 |
| Molecular Formula | C27H24N4O6 |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | (2S)-N-(2,6-dimethylphenyl)-2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-methylamino]-2-(4-nitrophenyl)acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)[C@H](c1ccc([N+](=O)[O-])cc1)N(C)C(=O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C27H24N4O6/c1-16-7-6-8-17(2)23(16)28-25(33)24(18-11-13-19(14-12-18)31(36)37)29(3)22(32)15-30-26(34)20-9-4-5-10-21(20)27(30)35/h4-14,24H,15H2,1-3H3,(H,28,33)/t24-/m0/s1 |
| InChIKey | BLYRNNUJDLQDFP-DEOSSOPVSA-N |
| XLogP | 3.65 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|