C24H22FN3O4 — CID 1104140
N-[(1S)-2-(2,6-dimethylanilino)-1-(3-nitrophenyl)-2-oxoethyl]-2-fluoro-N-methylbenzamide (PubChem CID 1104140) has the molecular formula C24H22FN3O4 and a molecular weight of 435.46 g/mol. Its IUPAC name is N-[(1S)-2-(2,6-dimethylanilino)-1-(3-nitrophenyl)-2-oxoethyl]-2-fluoro-N-methylbenzamide.
| Compound Name | N-[(1S)-2-(2,6-dimethylanilino)-1-(3-nitrophenyl)-2-oxoethyl]-2-fluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 1104140 |
| Molecular Formula | C24H22FN3O4 |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | N-[(1S)-2-(2,6-dimethylanilino)-1-(3-nitrophenyl)-2-oxoethyl]-2-fluoro-N-methylbenzamide |
| SMILES | Cc1cccc(C)c1NC(=O)[C@H](c1cccc([N+](=O)[O-])c1)N(C)C(=O)c1ccccc1F |
| InChI | InChI=1S/C24H22FN3O4/c1-15-8-6-9-16(2)21(15)26-23(29)22(17-10-7-11-18(14-17)28(31)32)27(3)24(30)19-12-4-5-13-20(19)25/h4-14,22H,1-3H3,(H,26,29)/t22-/m0/s1 |
| InChIKey | RMNZQNKNANKIHQ-QFIPXVFZSA-N |
| XLogP | 4.80 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|